C14H9Cl2N7 — CID 2768603
3-(2,4-dichlorophenyl)-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]prop-2-enenitrile (PubChem CID 2768603) has the molecular formula C14H9Cl2N7 and a molecular weight of 346.18 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]prop-2-enenitrile.
| Compound Name | 3-(2,4-dichlorophenyl)-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2768603 |
| Molecular Formula | C14H9Cl2N7 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(Cl)cc1Cl)c1n[nH]c(Cn2cncn2)n1 |
| InChI | InChI=1S/C14H9Cl2N7/c15-11-2-1-9(12(16)4-11)3-10(5-17)14-20-13(21-22-14)6-23-8-18-7-19-23/h1-4,7-8H,6H2,(H,20,21,22) |
| InChIKey | JDQUWCDWHPQMHZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|