C15H13N7O — CID 20850441
(Z)-3-(4-methoxyphenyl)-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]prop-2-enenitrile (PubChem CID 20850441) has the molecular formula C15H13N7O and a molecular weight of 307.32 g/mol. Its IUPAC name is (Z)-3-(4-methoxyphenyl)-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]prop-2-enenitrile.
| Compound Name | (Z)-3-(4-methoxyphenyl)-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 20850441 |
| Molecular Formula | C15H13N7O |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (Z)-3-(4-methoxyphenyl)-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazol-3-yl]prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(/C#N)c2n[nH]c(Cn3cncn3)n2)cc1 |
| InChI | InChI=1S/C15H13N7O/c1-23-13-4-2-11(3-5-13)6-12(7-16)15-19-14(20-21-15)8-22-10-17-9-18-22/h2-6,9-10H,8H2,1H3,(H,19,20,21)/b12-6- |
| InChIKey | YTVKCLLZBWSTTL-SDQBBNPISA-N |
| XLogP | 1.52 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|