C32H26N6O2 — CID 102369506
(E)-3-[4-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]phenyl]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 102369506) has the molecular formula C32H26N6O2 and a molecular weight of 526.60 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]phenyl]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]phenyl]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 102369506 |
| Molecular Formula | C32H26N6O2 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | (E)-3-[4-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]phenyl]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | COc1ccc(N(c2ccc(/C=C/c3ccc(/C=C(\C#N)c4nn[nH]n4)cc3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H26N6O2/c1-39-30-17-13-28(14-18-30)38(29-15-19-31(40-2)20-16-29)27-11-9-24(10-12-27)4-3-23-5-7-25(8-6-23)21-26(22-33)32-34-36-37-35-32/h3-21H,1-2H3,(H,34,35,36,37)/b4-3+,26-21+ |
| InChIKey | DZYPTWJAZUTFFT-FKOSWOJBSA-N |
| XLogP | 6.92 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|