C20H19N5 — CID 3593176
2-(5-benzyl-1H-1,2,4-triazol-3-yl)-3-[4-(dimethylamino)phenyl]prop-2-enenitrile (PubChem CID 3593176) has the molecular formula C20H19N5 and a molecular weight of 329.41 g/mol. Its IUPAC name is 2-(5-benzyl-1H-1,2,4-triazol-3-yl)-3-[4-(dimethylamino)phenyl]prop-2-enenitrile.
| Compound Name | 2-(5-benzyl-1H-1,2,4-triazol-3-yl)-3-[4-(dimethylamino)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3593176 |
| Molecular Formula | C20H19N5 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-(5-benzyl-1H-1,2,4-triazol-3-yl)-3-[4-(dimethylamino)phenyl]prop-2-enenitrile |
| SMILES | CN(C)c1ccc(C=C(C#N)c2n[nH]c(Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H19N5/c1-25(2)18-10-8-16(9-11-18)12-17(14-21)20-22-19(23-24-20)13-15-6-4-3-5-7-15/h3-12H,13H2,1-2H3,(H,22,23,24) |
| InChIKey | DNVANFZUADSUPK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|