C19H15N3OS — CID 6194020
(E)-3-[4-(dimethylamino)phenyl]-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile (PubChem CID 6194020) has the molecular formula C19H15N3OS and a molecular weight of 333.42 g/mol. Its IUPAC name is (E)-3-[4-(dimethylamino)phenyl]-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-(dimethylamino)phenyl]-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6194020 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (E)-3-[4-(dimethylamino)phenyl]-2-(4-oxo-1,3-benzothiazin-2-yl)prop-2-enenitrile |
| SMILES | CN(C)c1ccc(/C=C(\C#N)c2nc(=O)c3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H15N3OS/c1-22(2)15-9-7-13(8-10-15)11-14(12-20)19-21-18(23)16-5-3-4-6-17(16)24-19/h3-11H,1-2H3/b14-11+ |
| InChIKey | CWXBENWWEJUFJY-SDNWHVSQSA-N |
| XLogP | 3.79 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|