C17H14Cl2N2S — CID 92969026
(Z)-3-(2,4-dichlorophenyl)-2-[(6R)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]prop-2-enenitrile (PubChem CID 92969026) has the molecular formula C17H14Cl2N2S and a molecular weight of 349.29 g/mol. Its IUPAC name is (Z)-3-(2,4-dichlorophenyl)-2-[(6R)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]prop-2-enenitrile.
| Compound Name | (Z)-3-(2,4-dichlorophenyl)-2-[(6R)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 92969026 |
| Molecular Formula | C17H14Cl2N2S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | (Z)-3-(2,4-dichlorophenyl)-2-[(6R)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]prop-2-enenitrile |
| SMILES | C[C@@H]1CCc2nc(/C(C#N)=C\c3ccc(Cl)cc3Cl)sc2C1 |
| InChI | InChI=1S/C17H14Cl2N2S/c1-10-2-5-15-16(6-10)22-17(21-15)12(9-20)7-11-3-4-13(18)8-14(11)19/h3-4,7-8,10H,2,5-6H2,1H3/b12-7-/t10-/m1/s1 |
| InChIKey | JMNAWIFZAZDKDD-VPMLRQHESA-N |
| XLogP | 5.64 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|