C23H23N3S — CID 6152922
(E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enenitrile (PubChem CID 6152922) has the molecular formula C23H23N3S and a molecular weight of 373.53 g/mol. Its IUPAC name is (E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6152922 |
| Molecular Formula | C23H23N3S |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | (E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)c2nc3c(s2)CC(C)CC3)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C23H23N3S/c1-15-9-10-21-22(11-15)27-23(25-21)19(14-24)13-18-12-16(2)26(17(18)3)20-7-5-4-6-8-20/h4-8,12-13,15H,9-11H2,1-3H3/b19-13+ |
| InChIKey | ARFLGSJNGUZGHA-CPNJWEJPSA-N |
| XLogP | 5.74 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|