C23H22BrN3S — CID 6019422
(E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enenitrile (PubChem CID 6019422) has the molecular formula C23H22BrN3S and a molecular weight of 452.42 g/mol. Its IUPAC name is (E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6019422 |
| Molecular Formula | C23H22BrN3S |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | (E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)c2nc3c(s2)CC(C)CC3)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H22BrN3S/c1-14-4-9-21-22(10-14)28-23(26-21)18(13-25)12-17-11-15(2)27(16(17)3)20-7-5-19(24)6-8-20/h5-8,11-12,14H,4,9-10H2,1-3H3/b18-12+ |
| InChIKey | COOYYYZPIPYIJJ-LDADJPATSA-N |
| XLogP | 6.50 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|