C17H15ClN2S — CID 6260610
(E)-3-(4-chlorophenyl)-2-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enenitrile (PubChem CID 6260610) has the molecular formula C17H15ClN2S and a molecular weight of 314.84 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-2-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-chlorophenyl)-2-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6260610 |
| Molecular Formula | C17H15ClN2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-2-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)prop-2-enenitrile |
| SMILES | CC1CCc2nc(/C(C#N)=C/c3ccc(Cl)cc3)sc2C1 |
| InChI | InChI=1S/C17H15ClN2S/c1-11-2-7-15-16(8-11)21-17(20-15)13(10-19)9-12-3-5-14(18)6-4-12/h3-6,9,11H,2,7-8H2,1H3/b13-9+ |
| InChIKey | AOEWXDASOHRGBK-UKTHLTGXSA-N |
| XLogP | 4.99 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|