C23H20N2OS — CID 7741892
(E)-2-[(6S)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-(3-phenoxyphenyl)prop-2-enenitrile (PubChem CID 7741892) has the molecular formula C23H20N2OS and a molecular weight of 372.49 g/mol. Its IUPAC name is (E)-2-[(6S)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-(3-phenoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-[(6S)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-(3-phenoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 7741892 |
| Molecular Formula | C23H20N2OS |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (E)-2-[(6S)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-(3-phenoxyphenyl)prop-2-enenitrile |
| SMILES | C[C@H]1CCc2nc(/C(C#N)=C/c3cccc(Oc4ccccc4)c3)sc2C1 |
| InChI | InChI=1S/C23H20N2OS/c1-16-10-11-21-22(12-16)27-23(25-21)18(15-24)13-17-6-5-9-20(14-17)26-19-7-3-2-4-8-19/h2-9,13-14,16H,10-12H2,1H3/b18-13+/t16-/m0/s1 |
| InChIKey | FWLGZHADLWXSOH-HZGBGQKMSA-N |
| XLogP | 6.12 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|