C22H13ClN2OS — CID 75409581
(Z)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-chlorophenoxy)phenyl]prop-2-enenitrile (PubChem CID 75409581) has the molecular formula C22H13ClN2OS and a molecular weight of 388.88 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-chlorophenoxy)phenyl]prop-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-chlorophenoxy)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 75409581 |
| Molecular Formula | C22H13ClN2OS |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-chlorophenoxy)phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cccc(Oc2ccc(Cl)cc2)c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H13ClN2OS/c23-17-8-10-18(11-9-17)26-19-5-3-4-15(13-19)12-16(14-24)22-25-20-6-1-2-7-21(20)27-22/h1-13H/b16-12- |
| InChIKey | ZIUBFXNCAJVICY-VBKFSLOCSA-N |
| XLogP | 6.81 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|