C24H16N2O3S — CID 4637256
[3-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] 4-methoxybenzoate (PubChem CID 4637256) has the molecular formula C24H16N2O3S and a molecular weight of 412.47 g/mol. Its IUPAC name is [3-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] 4-methoxybenzoate.
| Compound Name | [3-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 4637256 |
| Molecular Formula | C24H16N2O3S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [3-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2cccc(C=C(C#N)c3nc4ccccc4s3)c2)cc1 |
| InChI | InChI=1S/C24H16N2O3S/c1-28-19-11-9-17(10-12-19)24(27)29-20-6-4-5-16(14-20)13-18(15-25)23-26-21-7-2-3-8-22(21)30-23/h2-14H,1H3 |
| InChIKey | ZOPHJTSLAGCKQQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|