C20H15ClN4S — CID 101002309
(Z)-3-(4-chlorophenyl)-2-[4-methyl-5-[(4-methylphenyl)diazenyl]-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 101002309) has the molecular formula C20H15ClN4S and a molecular weight of 378.89 g/mol. Its IUPAC name is (Z)-3-(4-chlorophenyl)-2-[4-methyl-5-[(4-methylphenyl)diazenyl]-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (Z)-3-(4-chlorophenyl)-2-[4-methyl-5-[(4-methylphenyl)diazenyl]-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 101002309 |
| Molecular Formula | C20H15ClN4S |
| Molecular Weight | 378.89 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (Z)-3-(4-chlorophenyl)-2-[4-methyl-5-[(4-methylphenyl)diazenyl]-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | Cc1ccc(/N=N/c2sc(/C(C#N)=C\c3ccc(Cl)cc3)nc2C)cc1 |
| InChI | InChI=1S/C20H15ClN4S/c1-13-3-9-18(10-4-13)24-25-19-14(2)23-20(26-19)16(12-22)11-15-5-7-17(21)8-6-15/h3-11H,1-2H3/b16-11-,25-24+ |
| InChIKey | JCUOIWKHYYKMRG-WEXQZUKMSA-N |
| XLogP | 6.89 |
| TPSA | 61.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.89 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|