C20H16ClN3OS — CID 6259379
(E)-3-(4-chlorophenyl)-2-cyano-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide (PubChem CID 6259379) has the molecular formula C20H16ClN3OS and a molecular weight of 381.89 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-2-cyano-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-2-cyano-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6259379 |
| Molecular Formula | C20H16ClN3OS |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-2-cyano-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
| SMILES | CC1CCc2c(sc(NC(=O)/C(C#N)=C/c3ccc(Cl)cc3)c2C#N)C1 |
| InChI | InChI=1S/C20H16ClN3OS/c1-12-2-7-16-17(11-23)20(26-18(16)8-12)24-19(25)14(10-22)9-13-3-5-15(21)6-4-13/h3-6,9,12H,2,7-8H2,1H3,(H,24,25)/b14-9+ |
| InChIKey | COBUMDIWHAYRAI-NTEUORMPSA-N |
| XLogP | 4.94 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|