C23H23N3OS — CID 2790452
2-cyano-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 2790452) has the molecular formula C23H23N3OS and a molecular weight of 389.52 g/mol. Its IUPAC name is 2-cyano-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | 2-cyano-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2790452 |
| Molecular Formula | C23H23N3OS |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-cyano-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC1CCc2c(sc(NC(=O)C(C#N)=Cc3ccc(C(C)C)cc3)c2C#N)C1 |
| InChI | InChI=1S/C23H23N3OS/c1-14(2)17-7-5-16(6-8-17)11-18(12-24)22(27)26-23-20(13-25)19-9-4-15(3)10-21(19)28-23/h5-8,11,14-15H,4,9-10H2,1-3H3,(H,26,27) |
| InChIKey | BDBFAKGNLUHCEU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|