C30H22BrN3S2 — CID 167895492
(E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 167895492) has the molecular formula C30H22BrN3S2 and a molecular weight of 568.57 g/mol. Its IUPAC name is (E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 167895492 |
| Molecular Formula | C30H22BrN3S2 |
| Molecular Weight | 568.57 g/mol |
| Exact Mass | 567.04 |
| IUPAC Name | (E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)c2nc(-c3ccc(Sc4ccccc4)cc3)cs2)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C30H22BrN3S2/c1-20-16-23(21(2)34(20)26-12-10-25(31)11-13-26)17-24(18-32)30-33-29(19-35-30)22-8-14-28(15-9-22)36-27-6-4-3-5-7-27/h3-17,19H,1-2H3/b24-17+ |
| InChIKey | OZDCDMSLFRUYQD-JJIBRWJFSA-N |
| XLogP | 9.20 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.57 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|