C16H16Cl2N2O2S — CID 4861044
2-(2,4-dichlorophenoxy)-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 4861044) has the molecular formula C16H16Cl2N2O2S and a molecular weight of 371.29 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4861044 |
| Molecular Formula | C16H16Cl2N2O2S |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CC1CCc2nc(NC(=O)COc3ccc(Cl)cc3Cl)sc2C1 |
| InChI | InChI=1S/C16H16Cl2N2O2S/c1-9-2-4-12-14(6-9)23-16(19-12)20-15(21)8-22-13-5-3-10(17)7-11(13)18/h3,5,7,9H,2,4,6,8H2,1H3,(H,19,20,21) |
| InChIKey | IMQFNJDRZGWDQA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |