C15H15Cl2N3S2 — CID 19676543
1-(2,4-dichlorophenyl)-3-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea (PubChem CID 19676543) has the molecular formula C15H15Cl2N3S2 and a molecular weight of 372.35 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 19676543 |
| Molecular Formula | C15H15Cl2N3S2 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea |
| SMILES | CC1CCc2nc(NC(=S)Nc3ccc(Cl)cc3Cl)sc2C1 |
| InChI | InChI=1S/C15H15Cl2N3S2/c1-8-2-4-12-13(6-8)22-15(19-12)20-14(21)18-11-5-3-9(16)7-10(11)17/h3,5,7-8H,2,4,6H2,1H3,(H2,18,19,20,21) |
| InChIKey | BRSNMXREAGZAHB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|