C15H16N4O2S2 — CID 19676539
1-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)thiourea (PubChem CID 19676539) has the molecular formula C15H16N4O2S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)thiourea.
| Compound Name | 1-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 19676539 |
| Molecular Formula | C15H16N4O2S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 1-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)thiourea |
| SMILES | CC1CCc2nc(NC(=S)Nc3cccc([N+](=O)[O-])c3)sc2C1 |
| InChI | InChI=1S/C15H16N4O2S2/c1-9-5-6-12-13(7-9)23-15(17-12)18-14(22)16-10-3-2-4-11(8-10)19(20)21/h2-4,8-9H,5-7H2,1H3,(H2,16,17,18,22) |
| InChIKey | AQQGVVYETHWMKX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|