C16H19N3S2 — CID 19676524
1-(2-methylphenyl)-3-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea (PubChem CID 19676524) has the molecular formula C16H19N3S2 and a molecular weight of 317.48 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea.
| Compound Name | 1-(2-methylphenyl)-3-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 19676524 |
| Molecular Formula | C16H19N3S2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-(2-methylphenyl)-3-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea |
| SMILES | Cc1ccccc1NC(=S)Nc1nc2c(s1)CC(C)CC2 |
| InChI | InChI=1S/C16H19N3S2/c1-10-7-8-13-14(9-10)21-16(18-13)19-15(20)17-12-6-4-3-5-11(12)2/h3-6,10H,7-9H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | VCOWLSUNBAKFTI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|