C19H14I2N2O — CID 126372587
4-[(E)-1-cyano-2-(3,5-diiodo-4-propan-2-yloxyphenyl)ethenyl]benzonitrile (PubChem CID 126372587) has the molecular formula C19H14I2N2O and a molecular weight of 540.14 g/mol. Its IUPAC name is 4-[(E)-1-cyano-2-(3,5-diiodo-4-propan-2-yloxyphenyl)ethenyl]benzonitrile.
| Compound Name | 4-[(E)-1-cyano-2-(3,5-diiodo-4-propan-2-yloxyphenyl)ethenyl]benzonitrile |
|---|---|
| PubChem CID | 126372587 |
| Molecular Formula | C19H14I2N2O |
| Molecular Weight | 540.14 g/mol |
| Exact Mass | 539.92 |
| IUPAC Name | 4-[(E)-1-cyano-2-(3,5-diiodo-4-propan-2-yloxyphenyl)ethenyl]benzonitrile |
| SMILES | CC(C)Oc1c(I)cc(/C=C(/C#N)c2ccc(C#N)cc2)cc1I |
| InChI | InChI=1S/C19H14I2N2O/c1-12(2)24-19-17(20)8-14(9-18(19)21)7-16(11-23)15-5-3-13(10-22)4-6-15/h3-9,12H,1-2H3/b16-7- |
| InChIKey | OSRKSJNPCPKUHI-APSNUPSMSA-N |
| XLogP | 5.62 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.14 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|