C18H15I2NO — CID 126371439
(E)-3-(3,5-diiodo-4-propan-2-yloxyphenyl)-2-phenylprop-2-enenitrile (PubChem CID 126371439) has the molecular formula C18H15I2NO and a molecular weight of 515.13 g/mol. Its IUPAC name is (E)-3-(3,5-diiodo-4-propan-2-yloxyphenyl)-2-phenylprop-2-enenitrile.
| Compound Name | (E)-3-(3,5-diiodo-4-propan-2-yloxyphenyl)-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 126371439 |
| Molecular Formula | C18H15I2NO |
| Molecular Weight | 515.13 g/mol |
| Exact Mass | 514.92 |
| IUPAC Name | (E)-3-(3,5-diiodo-4-propan-2-yloxyphenyl)-2-phenylprop-2-enenitrile |
| SMILES | CC(C)Oc1c(I)cc(/C=C(/C#N)c2ccccc2)cc1I |
| InChI | InChI=1S/C18H15I2NO/c1-12(2)22-18-16(19)9-13(10-17(18)20)8-15(11-21)14-6-4-3-5-7-14/h3-10,12H,1-2H3/b15-8- |
| InChIKey | YBMBTAUUGGTNSJ-NVNXTCNLSA-N |
| XLogP | 5.75 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.13 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|