C19H17Cl2NO — CID 126051646
(Z)-3-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-2-phenylprop-2-enenitrile (PubChem CID 126051646) has the molecular formula C19H17Cl2NO and a molecular weight of 346.26 g/mol. Its IUPAC name is (Z)-3-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-2-phenylprop-2-enenitrile.
| Compound Name | (Z)-3-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 126051646 |
| Molecular Formula | C19H17Cl2NO |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | (Z)-3-[3,5-dichloro-4-(2-methylpropoxy)phenyl]-2-phenylprop-2-enenitrile |
| SMILES | CC(C)COc1c(Cl)cc(/C=C(\C#N)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C19H17Cl2NO/c1-13(2)12-23-19-17(20)9-14(10-18(19)21)8-16(11-22)15-6-4-3-5-7-15/h3-10,13H,12H2,1-2H3/b16-8+ |
| InChIKey | FSNYIJCXSMHCOE-LZYBPNLTSA-N |
| XLogP | 6.09 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|