C18H11Cl2NO — CID 126051284
(Z)-3-(3,5-dichloro-4-prop-2-ynoxyphenyl)-2-phenylprop-2-enenitrile (PubChem CID 126051284) has the molecular formula C18H11Cl2NO and a molecular weight of 328.20 g/mol. Its IUPAC name is (Z)-3-(3,5-dichloro-4-prop-2-ynoxyphenyl)-2-phenylprop-2-enenitrile.
| Compound Name | (Z)-3-(3,5-dichloro-4-prop-2-ynoxyphenyl)-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 126051284 |
| Molecular Formula | C18H11Cl2NO |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | (Z)-3-(3,5-dichloro-4-prop-2-ynoxyphenyl)-2-phenylprop-2-enenitrile |
| SMILES | C#CCOc1c(Cl)cc(/C=C(\C#N)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C18H11Cl2NO/c1-2-8-22-18-16(19)10-13(11-17(18)20)9-15(12-21)14-6-4-3-5-7-14/h1,3-7,9-11H,8H2/b15-9+ |
| InChIKey | DTOZQBSYYCGAKS-OQLLNIDSSA-N |
| XLogP | 5.07 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|