C22H14Br2INO — CID 126377805
(E)-3-(3,5-dibromo-4-phenylmethoxyphenyl)-2-(4-iodophenyl)prop-2-enenitrile (PubChem CID 126377805) has the molecular formula C22H14Br2INO and a molecular weight of 595.07 g/mol. Its IUPAC name is (E)-3-(3,5-dibromo-4-phenylmethoxyphenyl)-2-(4-iodophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-(3,5-dibromo-4-phenylmethoxyphenyl)-2-(4-iodophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126377805 |
| Molecular Formula | C22H14Br2INO |
| Molecular Weight | 595.07 g/mol |
| Exact Mass | 592.85 |
| IUPAC Name | (E)-3-(3,5-dibromo-4-phenylmethoxyphenyl)-2-(4-iodophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cc(Br)c(OCc2ccccc2)c(Br)c1)c1ccc(I)cc1 |
| InChI | InChI=1S/C22H14Br2INO/c23-20-11-16(10-18(13-26)17-6-8-19(25)9-7-17)12-21(24)22(20)27-14-15-4-2-1-3-5-15/h1-12H,14H2/b18-10- |
| InChIKey | SEWFLGZNZRAAMH-ZDLGFXPLSA-N |
| XLogP | 7.46 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.07 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|