C19H18BrNO5 — CID 87978462
(E)-1-(3-amino-4-ethoxyphenyl)-2-bromo-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one (PubChem CID 87978462) has the molecular formula C19H18BrNO5 and a molecular weight of 420.26 g/mol. Its IUPAC name is (E)-1-(3-amino-4-ethoxyphenyl)-2-bromo-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(3-amino-4-ethoxyphenyl)-2-bromo-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 87978462 |
| Molecular Formula | C19H18BrNO5 |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | (E)-1-(3-amino-4-ethoxyphenyl)-2-bromo-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C(=O)/C(Br)=C\c2cc(OC)c3c(c2)OCO3)cc1N |
| InChI | InChI=1S/C19H18BrNO5/c1-3-24-15-5-4-12(9-14(15)21)18(22)13(20)6-11-7-16(23-2)19-17(8-11)25-10-26-19/h4-9H,3,10,21H2,1-2H3/b13-6+ |
| InChIKey | CZQNWALOPUEHLJ-AWNIVKPZSA-N |
| XLogP | 4.02 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|