C18H24O7 — CID 134518346
dimethyl 2-[(4-hydroxy-3,5-dipropoxyphenyl)methylidene]propanedioate (PubChem CID 134518346) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is dimethyl 2-[(4-hydroxy-3,5-dipropoxyphenyl)methylidene]propanedioate.
| Compound Name | dimethyl 2-[(4-hydroxy-3,5-dipropoxyphenyl)methylidene]propanedioate |
|---|---|
| PubChem CID | 134518346 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | dimethyl 2-[(4-hydroxy-3,5-dipropoxyphenyl)methylidene]propanedioate |
| SMILES | CCCOc1cc(C=C(C(=O)OC)C(=O)OC)cc(OCCC)c1O |
| InChI | InChI=1S/C18H24O7/c1-5-7-24-14-10-12(11-15(16(14)19)25-8-6-2)9-13(17(20)22-3)18(21)23-4/h9-11,19H,5-8H2,1-4H3 |
| InChIKey | NMENYABRJWHVRY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|