C14H12Cl2O7 — CID 126069972
2-[2,6-dichloro-4-(3-methoxy-2-methoxycarbonyl-3-oxoprop-1-enyl)phenoxy]acetic acid (PubChem CID 126069972) has the molecular formula C14H12Cl2O7 and a molecular weight of 363.15 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-(3-methoxy-2-methoxycarbonyl-3-oxoprop-1-enyl)phenoxy]acetic acid.
| Compound Name | 2-[2,6-dichloro-4-(3-methoxy-2-methoxycarbonyl-3-oxoprop-1-enyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 126069972 |
| Molecular Formula | C14H12Cl2O7 |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 2-[2,6-dichloro-4-(3-methoxy-2-methoxycarbonyl-3-oxoprop-1-enyl)phenoxy]acetic acid |
| SMILES | COC(=O)C(=Cc1cc(Cl)c(OCC(=O)O)c(Cl)c1)C(=O)OC |
| InChI | InChI=1S/C14H12Cl2O7/c1-21-13(19)8(14(20)22-2)3-7-4-9(15)12(10(16)5-7)23-6-11(17)18/h3-5H,6H2,1-2H3,(H,17,18) |
| InChIKey | CTYQQPCVQJQYIO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|