C15H12Cl2O5 — CID 126053971
dimethyl 2-[(3,5-dichloro-2-prop-2-ynoxyphenyl)methylidene]propanedioate (PubChem CID 126053971) has the molecular formula C15H12Cl2O5 and a molecular weight of 343.16 g/mol. Its IUPAC name is dimethyl 2-[(3,5-dichloro-2-prop-2-ynoxyphenyl)methylidene]propanedioate.
| Compound Name | dimethyl 2-[(3,5-dichloro-2-prop-2-ynoxyphenyl)methylidene]propanedioate |
|---|---|
| PubChem CID | 126053971 |
| Molecular Formula | C15H12Cl2O5 |
| Molecular Weight | 343.16 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | dimethyl 2-[(3,5-dichloro-2-prop-2-ynoxyphenyl)methylidene]propanedioate |
| SMILES | C#CCOc1c(Cl)cc(Cl)cc1C=C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C15H12Cl2O5/c1-4-5-22-13-9(6-10(16)8-12(13)17)7-11(14(18)20-2)15(19)21-3/h1,6-8H,5H2,2-3H3 |
| InChIKey | OHVFLZABUDTCNF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|