C19H11Cl2FN2O2 — CID 126050890
(E)-2-cyano-3-(3,5-dichloro-2-prop-2-ynoxyphenyl)-N-(4-fluorophenyl)prop-2-enamide (PubChem CID 126050890) has the molecular formula C19H11Cl2FN2O2 and a molecular weight of 389.21 g/mol. Its IUPAC name is (E)-2-cyano-3-(3,5-dichloro-2-prop-2-ynoxyphenyl)-N-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3,5-dichloro-2-prop-2-ynoxyphenyl)-N-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126050890 |
| Molecular Formula | C19H11Cl2FN2O2 |
| Molecular Weight | 389.21 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | (E)-2-cyano-3-(3,5-dichloro-2-prop-2-ynoxyphenyl)-N-(4-fluorophenyl)prop-2-enamide |
| SMILES | C#CCOc1c(Cl)cc(Cl)cc1/C=C(\C#N)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H11Cl2FN2O2/c1-2-7-26-18-12(9-14(20)10-17(18)21)8-13(11-23)19(25)24-16-5-3-15(22)4-6-16/h1,3-6,8-10H,7H2,(H,24,25)/b13-8+ |
| InChIKey | CNYUNLNNNZNMRV-MDWZMJQESA-N |
| XLogP | 4.69 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.21 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|