C26H22Cl2N2O3 — CID 5126412
2-cyano-3-[3,5-dichloro-2-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]-N-phenylprop-2-enamide (PubChem CID 5126412) has the molecular formula C26H22Cl2N2O3 and a molecular weight of 481.38 g/mol. Its IUPAC name is 2-cyano-3-[3,5-dichloro-2-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]-N-phenylprop-2-enamide.
| Compound Name | 2-cyano-3-[3,5-dichloro-2-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 5126412 |
| Molecular Formula | C26H22Cl2N2O3 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 2-cyano-3-[3,5-dichloro-2-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]-N-phenylprop-2-enamide |
| SMILES | Cc1cc(C)cc(OCCOc2c(Cl)cc(Cl)cc2C=C(C#N)C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C26H22Cl2N2O3/c1-17-10-18(2)12-23(11-17)32-8-9-33-25-19(14-21(27)15-24(25)28)13-20(16-29)26(31)30-22-6-4-3-5-7-22/h3-7,10-15H,8-9H2,1-2H3,(H,30,31) |
| InChIKey | VSXREWORQMTZSR-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|