C13H16O5 — CID 134612547
1-(4-hydroxy-3,5-dimethoxyphenyl)pentane-1,2-dione (PubChem CID 134612547) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 1-(4-hydroxy-3,5-dimethoxyphenyl)pentane-1,2-dione.
| Compound Name | 1-(4-hydroxy-3,5-dimethoxyphenyl)pentane-1,2-dione |
|---|---|
| PubChem CID | 134612547 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 1-(4-hydroxy-3,5-dimethoxyphenyl)pentane-1,2-dione |
| SMILES | CCCC(=O)C(=O)c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C13H16O5/c1-4-5-9(14)12(15)8-6-10(17-2)13(16)11(7-8)18-3/h6-7,16H,4-5H2,1-3H3 |
| InChIKey | UBFPAILWUOKBPU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|