C9H8N2O2S — CID 122525902
methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate (PubChem CID 122525902) has the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. Its IUPAC name is methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate.
| Compound Name | methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 122525902 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate |
| SMILES | COC(=O)C(C#N)=Cc1scnc1C |
| InChI | InChI=1S/C9H8N2O2S/c1-6-8(14-5-11-6)3-7(4-10)9(12)13-2/h3,5H,1-2H3 |
| InChIKey | ZZKASHMRBBDZGT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|