methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate

C9H8N2O2S — CID 122525902

IUPACmethyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate
SMILESCOC(=O)C(C#N)=Cc1scnc1C
InChIInChI=1S/C9H8N2O2S/c1-6-8(14-5-11-6)3-7(4-10)9(12)13-2/h3,5H,1-2H3
InChIKeyZZKASHMRBBDZGT-UHFFFAOYSA-N
MW208.24 g/mol
LogP1.53
Rot. Bonds2

About methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate

methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate (PubChem CID 122525902) has the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. Its IUPAC name is methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate.

Molecular Properties

Compound Namemethyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate
PubChem CID122525902
Molecular FormulaC9H8N2O2S
Molecular Weight208.24 g/mol
Exact Mass208.03
IUPAC Namemethyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate
SMILESCOC(=O)C(C#N)=Cc1scnc1C
InChIInChI=1S/C9H8N2O2S/c1-6-8(14-5-11-6)3-7(4-10)9(12)13-2/h3,5H,1-2H3
InChIKeyZZKASHMRBBDZGT-UHFFFAOYSA-N
XLogP1.53
TPSA62.98 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.24
LogP ≤ 51.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate?
The IUPAC name of methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate (CID 122525902) is methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate.
What is the SMILES notation for methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate?
The canonical SMILES for methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate is COC(=O)C(C#N)=Cc1scnc1C.
What is the InChIKey of methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate?
The InChIKey is ZZKASHMRBBDZGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2S/c1-6-8(14-5-11-6)3-7(4-10)9(12)13-2/h3,5H,1-2H3.
What are the key properties of methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate?
methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate has a molecular weight of 208.24 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyano-3-(4-methyl-1,3-thiazol-5-yl)prop-2-enoate is sourced from PubChem (CID 122525902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).