C14H20N2O2 — CID 114193780
ethyl 5-(1,3,5-trimethylpyrazol-4-yl)hexa-2,4-dienoate (PubChem CID 114193780) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is ethyl 5-(1,3,5-trimethylpyrazol-4-yl)hexa-2,4-dienoate.
| Compound Name | ethyl 5-(1,3,5-trimethylpyrazol-4-yl)hexa-2,4-dienoate |
|---|---|
| PubChem CID | 114193780 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | ethyl 5-(1,3,5-trimethylpyrazol-4-yl)hexa-2,4-dienoate |
| SMILES | CCOC(=O)C=CC=C(C)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C14H20N2O2/c1-6-18-13(17)9-7-8-10(2)14-11(3)15-16(5)12(14)4/h7-9H,6H2,1-5H3 |
| InChIKey | FKMXTVTVDDCNNT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|