C11H18N2O — CID 103971270
(Z)-4-(1,3,5-trimethylpyrazol-4-yl)pent-3-en-2-ol (PubChem CID 103971270) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (Z)-4-(1,3,5-trimethylpyrazol-4-yl)pent-3-en-2-ol.
| Compound Name | (Z)-4-(1,3,5-trimethylpyrazol-4-yl)pent-3-en-2-ol |
|---|---|
| PubChem CID | 103971270 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (Z)-4-(1,3,5-trimethylpyrazol-4-yl)pent-3-en-2-ol |
| SMILES | C/C(=C/C(C)O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C11H18N2O/c1-7(6-8(2)14)11-9(3)12-13(5)10(11)4/h6,8,14H,1-5H3/b7-6- |
| InChIKey | JSKLULPPMUQHMI-SREVYHEPSA-N |
| XLogP | 1.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |