C7H11N3O2 — CID 28742914
N-hydroxy-1,3,5-trimethylpyrazole-4-carboxamide (PubChem CID 28742914) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is N-hydroxy-1,3,5-trimethylpyrazole-4-carboxamide.
| Compound Name | N-hydroxy-1,3,5-trimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 28742914 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | N-hydroxy-1,3,5-trimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(C)c1C(=O)NO |
| InChI | InChI=1S/C7H11N3O2/c1-4-6(7(11)9-12)5(2)10(3)8-4/h12H,1-3H3,(H,9,11) |
| InChIKey | FEKABQUTEVJXOE-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|