C13H15N3O — CID 19281566
1,3,5-trimethyl-N-phenylpyrazole-4-carboxamide (PubChem CID 19281566) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-phenylpyrazole-4-carboxamide.
| Compound Name | 1,3,5-trimethyl-N-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19281566 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 1,3,5-trimethyl-N-phenylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(C)c1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C13H15N3O/c1-9-12(10(2)16(3)15-9)13(17)14-11-7-5-4-6-8-11/h4-8H,1-3H3,(H,14,17) |
| InChIKey | PVAREJDJSSOKCX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |