C14H14FN3O3 — CID 103791455
2-fluoro-4-[(1,3,5-trimethylpyrazole-4-carbonyl)amino]benzoic acid (PubChem CID 103791455) has the molecular formula C14H14FN3O3 and a molecular weight of 291.28 g/mol. Its IUPAC name is 2-fluoro-4-[(1,3,5-trimethylpyrazole-4-carbonyl)amino]benzoic acid.
| Compound Name | 2-fluoro-4-[(1,3,5-trimethylpyrazole-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 103791455 |
| Molecular Formula | C14H14FN3O3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-fluoro-4-[(1,3,5-trimethylpyrazole-4-carbonyl)amino]benzoic acid |
| SMILES | Cc1nn(C)c(C)c1C(=O)Nc1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C14H14FN3O3/c1-7-12(8(2)18(3)17-7)13(19)16-9-4-5-10(14(20)21)11(15)6-9/h4-6H,1-3H3,(H,16,19)(H,20,21) |
| InChIKey | JQUYYEYASNOQJY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |