C13H11F4N3O — CID 19281483
1,3,5-trimethyl-N-(2,3,5,6-tetrafluorophenyl)pyrazole-4-carboxamide (PubChem CID 19281483) has the molecular formula C13H11F4N3O and a molecular weight of 301.24 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-(2,3,5,6-tetrafluorophenyl)pyrazole-4-carboxamide.
| Compound Name | 1,3,5-trimethyl-N-(2,3,5,6-tetrafluorophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19281483 |
| Molecular Formula | C13H11F4N3O |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 1,3,5-trimethyl-N-(2,3,5,6-tetrafluorophenyl)pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(C)c1C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H11F4N3O/c1-5-9(6(2)20(3)19-5)13(21)18-12-10(16)7(14)4-8(15)11(12)17/h4H,1-3H3,(H,18,21) |
| InChIKey | FELDCBDKANLURE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|