C12H8ClF4N3O — CID 19266677
4-chloro-1,5-dimethyl-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide (PubChem CID 19266677) has the molecular formula C12H8ClF4N3O and a molecular weight of 321.66 g/mol. Its IUPAC name is 4-chloro-1,5-dimethyl-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide.
| Compound Name | 4-chloro-1,5-dimethyl-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19266677 |
| Molecular Formula | C12H8ClF4N3O |
| Molecular Weight | 321.66 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 4-chloro-1,5-dimethyl-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide |
| SMILES | Cc1c(Cl)c(C(=O)Nc2c(F)c(F)cc(F)c2F)nn1C |
| InChI | InChI=1S/C12H8ClF4N3O/c1-4-7(13)10(19-20(4)2)12(21)18-11-8(16)5(14)3-6(15)9(11)17/h3H,1-2H3,(H,18,21) |
| InChIKey | OKYQKEBXEUWGJJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.66 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|