C12H5BrF7N3O — CID 19268135
4-bromo-1-methyl-N-(2,3,5,6-tetrafluorophenyl)-5-(trifluoromethyl)pyrazole-3-carboxamide (PubChem CID 19268135) has the molecular formula C12H5BrF7N3O and a molecular weight of 420.08 g/mol. Its IUPAC name is 4-bromo-1-methyl-N-(2,3,5,6-tetrafluorophenyl)-5-(trifluoromethyl)pyrazole-3-carboxamide.
| Compound Name | 4-bromo-1-methyl-N-(2,3,5,6-tetrafluorophenyl)-5-(trifluoromethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19268135 |
| Molecular Formula | C12H5BrF7N3O |
| Molecular Weight | 420.08 g/mol |
| Exact Mass | 418.95 |
| IUPAC Name | 4-bromo-1-methyl-N-(2,3,5,6-tetrafluorophenyl)-5-(trifluoromethyl)pyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2c(F)c(F)cc(F)c2F)c(Br)c1C(F)(F)F |
| InChI | InChI=1S/C12H5BrF7N3O/c1-23-10(12(18,19)20)5(13)8(22-23)11(24)21-9-6(16)3(14)2-4(15)7(9)17/h2H,1H3,(H,21,24) |
| InChIKey | ZWWIFYSYEWVGAR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.08 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|