C10H13BrF3N3O — CID 19268210
4-bromo-1-methyl-N-(2-methylpropyl)-5-(trifluoromethyl)pyrazole-3-carboxamide (PubChem CID 19268210) has the molecular formula C10H13BrF3N3O and a molecular weight of 328.13 g/mol. Its IUPAC name is 4-bromo-1-methyl-N-(2-methylpropyl)-5-(trifluoromethyl)pyrazole-3-carboxamide.
| Compound Name | 4-bromo-1-methyl-N-(2-methylpropyl)-5-(trifluoromethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19268210 |
| Molecular Formula | C10H13BrF3N3O |
| Molecular Weight | 328.13 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 4-bromo-1-methyl-N-(2-methylpropyl)-5-(trifluoromethyl)pyrazole-3-carboxamide |
| SMILES | CC(C)CNC(=O)c1nn(C)c(C(F)(F)F)c1Br |
| InChI | InChI=1S/C10H13BrF3N3O/c1-5(2)4-15-9(18)7-6(11)8(10(12,13)14)17(3)16-7/h5H,4H2,1-3H3,(H,15,18) |
| InChIKey | KMYUZYNSBOFELD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.13 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |