C11H9BrF3N3O2 — CID 19268242
4-bromo-N-(furan-2-ylmethyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide (PubChem CID 19268242) has the molecular formula C11H9BrF3N3O2 and a molecular weight of 352.11 g/mol. Its IUPAC name is 4-bromo-N-(furan-2-ylmethyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-(furan-2-ylmethyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19268242 |
| Molecular Formula | C11H9BrF3N3O2 |
| Molecular Weight | 352.11 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 4-bromo-N-(furan-2-ylmethyl)-1-methyl-5-(trifluoromethyl)pyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCc2ccco2)c(Br)c1C(F)(F)F |
| InChI | InChI=1S/C11H9BrF3N3O2/c1-18-9(11(13,14)15)7(12)8(17-18)10(19)16-5-6-3-2-4-20-6/h2-4H,5H2,1H3,(H,16,19) |
| InChIKey | PGFCNQUEVSDXQI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.11 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |