C10H10BrClF3N3O2 — CID 19268221
4-[[4-bromo-1-methyl-5-(trifluoromethyl)pyrazole-3-carbonyl]amino]butanoyl chloride (PubChem CID 19268221) has the molecular formula C10H10BrClF3N3O2 and a molecular weight of 376.56 g/mol. Its IUPAC name is 4-[[4-bromo-1-methyl-5-(trifluoromethyl)pyrazole-3-carbonyl]amino]butanoyl chloride.
| Compound Name | 4-[[4-bromo-1-methyl-5-(trifluoromethyl)pyrazole-3-carbonyl]amino]butanoyl chloride |
|---|---|
| PubChem CID | 19268221 |
| Molecular Formula | C10H10BrClF3N3O2 |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | 4-[[4-bromo-1-methyl-5-(trifluoromethyl)pyrazole-3-carbonyl]amino]butanoyl chloride |
| SMILES | Cn1nc(C(=O)NCCCC(=O)Cl)c(Br)c1C(F)(F)F |
| InChI | InChI=1S/C10H10BrClF3N3O2/c1-18-8(10(13,14)15)6(11)7(17-18)9(20)16-4-2-3-5(12)19/h2-4H2,1H3,(H,16,20) |
| InChIKey | FGIMKDKGJUISSI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|