4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride

C10H14ClN3O2 — CID 19279626

IUPAC4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride
SMILESCc1cc(C(=O)NCCCC(=O)Cl)nn1C
InChIInChI=1S/C10H14ClN3O2/c1-7-6-8(13-14(7)2)10(16)12-5-3-4-9(11)15/h6H,3-5H2,1-2H3,(H,12,16)
InChIKeyWPYYRWUOAPCESF-UHFFFAOYSA-N
MW243.69 g/mol
LogP1.00
Rot. Bonds5

About 4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride

4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride (PubChem CID 19279626) has the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. Its IUPAC name is 4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride.

Molecular Properties

Compound Name4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride
PubChem CID19279626
Molecular FormulaC10H14ClN3O2
Molecular Weight243.69 g/mol
Exact Mass243.08
IUPAC Name4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride
SMILESCc1cc(C(=O)NCCCC(=O)Cl)nn1C
InChIInChI=1S/C10H14ClN3O2/c1-7-6-8(13-14(7)2)10(16)12-5-3-4-9(11)15/h6H,3-5H2,1-2H3,(H,12,16)
InChIKeyWPYYRWUOAPCESF-UHFFFAOYSA-N
XLogP1.00
TPSA63.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.69
LogP ≤ 51.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride?
The IUPAC name of 4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride (CID 19279626) is 4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride.
What is the SMILES notation for 4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride?
The canonical SMILES for 4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride is Cc1cc(C(=O)NCCCC(=O)Cl)nn1C.
What is the InChIKey of 4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride?
The InChIKey is WPYYRWUOAPCESF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN3O2/c1-7-6-8(13-14(7)2)10(16)12-5-3-4-9(11)15/h6H,3-5H2,1-2H3,(H,12,16).
What are the key properties of 4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride?
4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride has a molecular weight of 243.69 g/mol, XLogP of 1.00, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,5-dimethylpyrazole-3-carbonyl)amino]butanoyl chloride is sourced from PubChem (CID 19279626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).