C14H18N6O4 — CID 19498431
3-[2-[(1,5-dimethylpyrazole-3-carbonyl)amino]ethylcarbamoyl]-1-methylpyrazole-4-carboxylic acid (PubChem CID 19498431) has the molecular formula C14H18N6O4 and a molecular weight of 334.34 g/mol. Its IUPAC name is 3-[2-[(1,5-dimethylpyrazole-3-carbonyl)amino]ethylcarbamoyl]-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 3-[2-[(1,5-dimethylpyrazole-3-carbonyl)amino]ethylcarbamoyl]-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 19498431 |
| Molecular Formula | C14H18N6O4 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3-[2-[(1,5-dimethylpyrazole-3-carbonyl)amino]ethylcarbamoyl]-1-methylpyrazole-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)NCCNC(=O)c2nn(C)cc2C(=O)O)nn1C |
| InChI | InChI=1S/C14H18N6O4/c1-8-6-10(17-20(8)3)12(21)15-4-5-16-13(22)11-9(14(23)24)7-19(2)18-11/h6-7H,4-5H2,1-3H3,(H,15,21)(H,16,22)(H,23,24) |
| InChIKey | HQEBLNAIDDTCEZ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 131.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|