C11H13BrF3N3O3S — CID 19268224
ethyl (2R)-2-[[4-bromo-1-methyl-5-(trifluoromethyl)pyrazole-3-carbonyl]amino]-3-sulfanylpropanoate (PubChem CID 19268224) has the molecular formula C11H13BrF3N3O3S and a molecular weight of 404.21 g/mol. Its IUPAC name is ethyl (2R)-2-[[4-bromo-1-methyl-5-(trifluoromethyl)pyrazole-3-carbonyl]amino]-3-sulfanylpropanoate.
| Compound Name | ethyl (2R)-2-[[4-bromo-1-methyl-5-(trifluoromethyl)pyrazole-3-carbonyl]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 19268224 |
| Molecular Formula | C11H13BrF3N3O3S |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | ethyl (2R)-2-[[4-bromo-1-methyl-5-(trifluoromethyl)pyrazole-3-carbonyl]amino]-3-sulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CS)NC(=O)c1nn(C)c(C(F)(F)F)c1Br |
| InChI | InChI=1S/C11H13BrF3N3O3S/c1-3-21-10(20)5(4-22)16-9(19)7-6(12)8(11(13,14)15)18(2)17-7/h5,22H,3-4H2,1-2H3,(H,16,19)/t5-/m0/s1 |
| InChIKey | ORPWASQEOZTKSV-YFKPBYRVSA-N |
| XLogP | 1.79 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|