C14H12ClF2N3O3 — CID 95748394
methyl 4-[(2-chloro-4,5-difluorobenzoyl)amino]-1,5-dimethylpyrazole-3-carboxylate (PubChem CID 95748394) has the molecular formula C14H12ClF2N3O3 and a molecular weight of 343.72 g/mol. Its IUPAC name is methyl 4-[(2-chloro-4,5-difluorobenzoyl)amino]-1,5-dimethylpyrazole-3-carboxylate.
| Compound Name | methyl 4-[(2-chloro-4,5-difluorobenzoyl)amino]-1,5-dimethylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 95748394 |
| Molecular Formula | C14H12ClF2N3O3 |
| Molecular Weight | 343.72 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | methyl 4-[(2-chloro-4,5-difluorobenzoyl)amino]-1,5-dimethylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(C)c(C)c1NC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C14H12ClF2N3O3/c1-6-11(12(14(22)23-3)19-20(6)2)18-13(21)7-4-9(16)10(17)5-8(7)15/h4-5H,1-3H3,(H,18,21) |
| InChIKey | PNTKTPNNBIXLLD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.72 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|