About N'-benzoyl-1,3,5-trimethylpyrazole-4-carbohydrazide
N'-benzoyl-1,3,5-trimethylpyrazole-4-carbohydrazide (PubChem CID 24672088) has the molecular formula C14H16N4O2
and a molecular weight of 272.31 g/mol. Its IUPAC name is N'-benzoyl-1,3,5-trimethylpyrazole-4-carbohydrazide.
Molecular Properties
| Compound Name | N'-benzoyl-1,3,5-trimethylpyrazole-4-carbohydrazide |
| PubChem CID | 24672088 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N'-benzoyl-1,3,5-trimethylpyrazole-4-carbohydrazide |
| SMILES | Cc1nn(C)c(C)c1C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16N4O2/c1-9-12(10(2)18(3)17-9)14(20)16-15-13(19)11-7-5-4-6-8-11/h4-8H,1-3H3,(H,15,19)(H,16,20) |
| InChIKey | GHNNPYWZNWCFBZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-benzoyl-1,3,5-trimethylpyrazole-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzoyl-1,3,5-trimethylpyrazole-4-carbohydrazide?
The IUPAC name of N'-benzoyl-1,3,5-trimethylpyrazole-4-carbohydrazide (CID 24672088) is N'-benzoyl-1,3,5-trimethylpyrazole-4-carbohydrazide.
What is the SMILES notation for N'-benzoyl-1,3,5-trimethylpyrazole-4-carbohydrazide?
The canonical SMILES for N'-benzoyl-1,3,5-trimethylpyrazole-4-carbohydrazide is Cc1nn(C)c(C)c1C(=O)NNC(=O)c1ccccc1.
What is the InChIKey of N'-benzoyl-1,3,5-trimethylpyrazole-4-carbohydrazide?
The InChIKey is GHNNPYWZNWCFBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O2/c1-9-12(10(2)18(3)17-9)14(20)16-15-13(19)11-7-5-4-6-8-11/h4-8H,1-3H3,(H,15,19)(H,16,20).
What are the key properties of N'-benzoyl-1,3,5-trimethylpyrazole-4-carbohydrazide?
N'-benzoyl-1,3,5-trimethylpyrazole-4-carbohydrazide has a molecular weight of 272.31 g/mol, XLogP of 1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzoyl-1,3,5-trimethylpyrazole-4-carbohydrazide is sourced from PubChem (CID 24672088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).