C11H18BrN3O — CID 114312498
N-(3-bromobutyl)-1,3,5-trimethylpyrazole-4-carboxamide (PubChem CID 114312498) has the molecular formula C11H18BrN3O and a molecular weight of 288.19 g/mol. Its IUPAC name is N-(3-bromobutyl)-1,3,5-trimethylpyrazole-4-carboxamide.
| Compound Name | N-(3-bromobutyl)-1,3,5-trimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 114312498 |
| Molecular Formula | C11H18BrN3O |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | N-(3-bromobutyl)-1,3,5-trimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(C)c1C(=O)NCCC(C)Br |
| InChI | InChI=1S/C11H18BrN3O/c1-7(12)5-6-13-11(16)10-8(2)14-15(4)9(10)3/h7H,5-6H2,1-4H3,(H,13,16) |
| InChIKey | XKQGSPQACZJYKH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|